CAS 4156-24-5 is the registry number for 3-(3,4-Dimethoxyphenyl)butan-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(3,4-dimethoxyphenyl)butan-2-one (CAS 4156-24-5) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)butan-2-one. InChIKey: DIWFDYWHQAEIMY-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)butan-2-one |
| InChIKey | DIWFDYWHQAEIMY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)OC)OC)C(=O)C |
Computed by PubChem (NCBI)