Products 415952-34-0

CAS 415952-34-0 is the registry number for 4-[4-(2-Hydroxy-ethyl)-piperazin-1-ylmethyl]-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoate (CAS 415952-34-0) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: methyl 4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoate. InChIKey: IJRVVDLIBWNIQV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O3
Molecular weight278.35 g/mol
IUPAC namemethyl 4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzoate
InChIKeyIJRVVDLIBWNIQV-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)CN2CCN(CC2)CCO

Computed by PubChem (NCBI)