Products 41610-69-9
CAS 41610-69-9 is the registry number for Ylangenol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
[(6R,7R,8S)-1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]dec-3-enyl]methanol (CAS 41610-69-9) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: [(6R,7R,8S)-1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]dec-3-enyl]methanol. InChIKey: JIXPRNKLOIEGFI-JIPNABBHSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | [(6R,7R,8S)-1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]dec-3-enyl]methanol |
| InChIKey | JIXPRNKLOIEGFI-JIPNABBHSA-N |
| SMILES | CC(C)[C@@H]1CCC2([C@H]3[C@@H]1C2C(=CC3)CO)C |
Computed by PubChem (NCBI)