Products 41743-38-8
CAS 41743-38-8 is the registry number for Bavachromene. Offered by: TargetMol, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg.
(E)-1-(7-hydroxy-2,2-dimethylchromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 41743-38-8) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: (E)-1-(7-hydroxy-2,2-dimethylchromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: LYPURLGLYLCBSU-VMPITWQZSA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (E)-1-(7-hydroxy-2,2-dimethylchromen-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | LYPURLGLYLCBSU-VMPITWQZSA-N |
| SMILES | CC1(C=CC2=CC(=C(C=C2O1)O)C(=O)/C=C/C3=CC=C(C=C3)O)C |
Computed by PubChem (NCBI)