Products 41904-39-6
CAS 41904-39-6 appears in our catalog under these names: (3-Chlorophenyl)acetyl chloride, 2-(3-Chlorophenyl)acetyl chloride 95+%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,25g, 100mg, 250mg, 1g.
2-(3-chlorophenyl)acetyl chloride (CAS 41904-39-6) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 2-(3-chlorophenyl)acetyl chloride. InChIKey: PYPMKORNJLTHGP-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 2-(3-chlorophenyl)acetyl chloride |
| InChIKey | PYPMKORNJLTHGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(3-chlorophenyl)acetyl Chloride, (3-chlorophenyl)acetyl chloride, m-Chlorophenylacetyl chloride, 3-chlorobenzeneacetyl chloride, 3-chlorophenylacetyl chloride, 2-(3-chlorophenyl)acetylChloride, PYPMKORNJLTHGP-UHFFFAOYSA-N, Benzeneacetyl chloride, 3-chloro-, 3-chlorophenyl acetic acid chloride, ClC(=O)CC1=CC(Cl)=CC=C1