Products 41927-06-4
CAS 41927-06-4 is the registry number for DHFR-IN-19. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(5,6-dimethyl-1H-benzimidazol-2-yl)guanidine (CAS 41927-06-4) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 2-(5,6-dimethyl-1H-benzimidazol-2-yl)guanidine. InChIKey: ITKFRENCGKAVOT-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-(5,6-dimethyl-1H-benzimidazol-2-yl)guanidine |
| InChIKey | ITKFRENCGKAVOT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C(N2)N=C(N)N |
Computed by PubChem (NCBI)