CAS 41998-38-3 is the registry number for (S)-CPP. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-chloro-3-phenylpropanoic acid (CAS 41998-38-3) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: (2S)-2-chloro-3-phenylpropanoic acid. InChIKey: LIDRHDRWTSPELB-QMMMGPOBSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | (2S)-2-chloro-3-phenylpropanoic acid |
| InChIKey | LIDRHDRWTSPELB-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)Cl |
Computed by PubChem (NCBI)