CAS 42014-60-8 appears in our catalog under these names: 4–(tert–Butyl)–2,6–dimethylaniline, 4-(tert-Butyl)-2,6-dimethylaniline 98%, 4-tert-Butyl-2,6-dimethylaniline, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g.
4-tert-butyl-2,6-dimethylaniline (CAS 42014-60-8) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: 4-tert-butyl-2,6-dimethylaniline. InChIKey: CHHGWEBJQVWINZ-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | 4-tert-butyl-2,6-dimethylaniline |
| InChIKey | CHHGWEBJQVWINZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)C(C)(C)C |
Computed by PubChem (NCBI)