CAS 56105-81-8 appears in our catalog under these names: (R)-2-(3-Benzoylphenyl)propanoic acid, 95%, (R)-Ketoprofen, (R)-(-)-Ketoprofen, >95% (HPLC), (R)-(-)-Ketoprofen, (R)-Ketoprofen, 95.0%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, on request, 10mg, 25mg, 50mg, 0,05g, 0,1g, 0,25g.
(2R)-2-(3-benzoylphenyl)propanoic acid (CAS 56105-81-8) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (2R)-2-(3-benzoylphenyl)propanoic acid. InChIKey: DKYWVDODHFEZIM-LLVKDONJSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (2R)-2-(3-benzoylphenyl)propanoic acid |
| InChIKey | DKYWVDODHFEZIM-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)