CAS 4208-77-9 appears in our catalog under these names: (2R,3S,4R,5R)–2–(hydroxymethyl)–2–methoxytetrahydro–2H–pyran–3,4,5–triol, Methyl β-D-fructopyranoside, 98.00%, Methyl β-D-fructopyranoside. Offered by: GLPBio, Chemat, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 5mg.
(2R,3S,4R,5R)-2-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (CAS 4208-77-9) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol. InChIKey: APKXYJAUJLWHFF-MVIOUDGNSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| InChIKey | APKXYJAUJLWHFF-MVIOUDGNSA-N |
| SMILES | CO[C@]1([C@H]([C@@H]([C@@H](CO1)O)O)O)CO |
Computed by PubChem (NCBI)