CAS 42089-79-2 is the registry number for 1-Phenyl 1H-5-(2'-hydroxyphenyl)pyrazole. Offered by: Biosynth. Available pack sizes: 10g, 25g, 50g.
2-(2-phenylpyrazol-3-yl)phenol (CAS 42089-79-2) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 2-(2-phenylpyrazol-3-yl)phenol. InChIKey: CFXSXOABKUKAOD-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 2-(2-phenylpyrazol-3-yl)phenol |
| InChIKey | CFXSXOABKUKAOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC=N2)C3=CC=CC=C3O |
Computed by PubChem (NCBI)