CAS 4214-75-9 appears in our catalog under these names: 2–Amino–3–nitropyridine, 2-Amino-3-nitropyridine/ 99%, 2-Amino-3-nitropyridine, 2-Amino-3-nitropyridine, 99%, 2-Amino-3-nitropyridine, >98.0%(T). Offered by: GLPBio, Chemat, Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 100g, 25g, 5g, 0,1kg, 0,05kg, 0,25kg, 0,5kg, 1000g.
3-nitropyridin-2-amine (CAS 4214-75-9) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 3-nitropyridin-2-amine. InChIKey: BPYHGTCRXDWOIQ-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 3-nitropyridin-2-amine |
| InChIKey | BPYHGTCRXDWOIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)