CAS 4222-96-2 appears in our catalog under these names: Levonorgestrel EP Impurity N, Levonorgestrel Impurity 14(Levonorgestrel EP Impurity N). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(8R,9S,13S,14S)-13-ethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (CAS 4222-96-2) is a chemical compound with the molecular formula C19H26O2 and a molecular weight of 286.4 g/mol. IUPAC name: (8R,9S,13S,14S)-13-ethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione. InChIKey: FUYOSZYGTZFADU-VXNCWWDNSA-N.
| Molecular formula | C19H26O2 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (8R,9S,13S,14S)-13-ethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | FUYOSZYGTZFADU-VXNCWWDNSA-N |
| SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3CCC(=O)C4 |
Computed by PubChem (NCBI)