CAS 422277-16-5 is the registry number for 4-Oxo-2-sulfanyl-3,4-dihydroquinazoline-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylic acid (CAS 422277-16-5) is a chemical compound with the molecular formula C9H6N2O3S and a molecular weight of 222.22 g/mol. IUPAC name: 4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylic acid. InChIKey: FUSOIMWPMXIWLV-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3S |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | 4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylic acid |
| InChIKey | FUSOIMWPMXIWLV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=S)NC2=O |
Computed by PubChem (NCBI)