CAS 63698-52-2 is the registry number for 5-(1,3-Dioxaindan-5-yl)-1,3,4-oxadiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(1,3-benzodioxol-5-yl)-3H-1,3,4-oxadiazole-2-thione (CAS 63698-52-2) is a chemical compound with the molecular formula C9H6N2O3S and a molecular weight of 222.22 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: JPZJNDJPRJSGGH-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3S |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | JPZJNDJPRJSGGH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NNC(=S)O3 |
Computed by PubChem (NCBI)