CAS 4225-35-8 is the registry number for 4,6-Dimethoxy-2,3-dihydro-1-benzofuran-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,6-dimethoxy-1-benzofuran-3-one (CAS 4225-35-8) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4,6-dimethoxy-1-benzofuran-3-one. InChIKey: LXQJNUVFRZIYBH-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4,6-dimethoxy-1-benzofuran-3-one |
| InChIKey | LXQJNUVFRZIYBH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=O)CO2)C(=C1)OC |
Computed by PubChem (NCBI)