CAS 42288-20-0 appears in our catalog under these names: N-(3-Bromophenyl)glycine, 97%, 2-((3-Bromophenyl)amino)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
2-(3-bromoanilino)acetic acid (CAS 42288-20-0) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-(3-bromoanilino)acetic acid. InChIKey: OXCSUXIQYMOULR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-(3-bromoanilino)acetic acid |
| InChIKey | OXCSUXIQYMOULR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NCC(=O)O |
Computed by PubChem (NCBI)