CAS 423165-33-7 appears in our catalog under these names: 2–Bromo–5–nitrophenetole, 2-Bromo-5-nitrophenetole, 1-Bromo-2-ethoxy-4-nitrobenzene 97%, 1-Bromo-2-ethoxy-4-nitrobenzene, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 100g, 50g, 500g, 1g, 10g.
1-bromo-2-ethoxy-4-nitrobenzene (CAS 423165-33-7) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 1-bromo-2-ethoxy-4-nitrobenzene. InChIKey: ZALXYXWTUXLPBJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 1-bromo-2-ethoxy-4-nitrobenzene |
| InChIKey | ZALXYXWTUXLPBJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)