CAS 42327-52-6 appears in our catalog under these names: 7-methoxy-2,3-dihydro-1-benzopyran-4-one, 98%, 7–Methoxychroman–4–one, 7-Methoxy-4-chromanone, 7-Methoxychroman-4-one 98%, 7-Methoxychroman-4-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g, 10g, 25g.
7-methoxy-2,3-dihydrochromen-4-one (CAS 42327-52-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 7-methoxy-2,3-dihydrochromen-4-one. InChIKey: DISYDHABSCTQFK-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 7-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | DISYDHABSCTQFK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)CCO2 |
Computed by PubChem (NCBI)