CAS 423737-09-1 appears in our catalog under these names: 1-(4-Hydroxyphenyl)piperidine-2,6-dione, 1-(4-Hydroxyphenyl)piperidine-2,6-dione, 97%. Offered by: Biosynth, Chemat Brand. Available pack sizes: 100mg, 1g, on request.
1-(4-hydroxyphenyl)piperidine-2,6-dione (CAS 423737-09-1) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 1-(4-hydroxyphenyl)piperidine-2,6-dione. InChIKey: COBPPHAXOHBWAN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)piperidine-2,6-dione |
| InChIKey | COBPPHAXOHBWAN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C(=O)C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)