CAS 423759-66-4 appears in our catalog under these names: Rac-(1r,2s,3r)-3-amino-1,2-cyclopentanediol hydrochloride, 95%, Rac-(1R,2S,3R)-3-amino-1,2-cyclopentanediol hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(1R,2S,3R)-3-aminocyclopentane-1,2-diol;hydrochloride (CAS 423759-66-4) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: (1R,2S,3R)-3-aminocyclopentane-1,2-diol;hydrochloride. InChIKey: KGKOUXFBWHTEOL-ZDQHTEEMSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | (1R,2S,3R)-3-aminocyclopentane-1,2-diol;hydrochloride |
| InChIKey | KGKOUXFBWHTEOL-ZDQHTEEMSA-N |
| SMILES | C1C[C@H]([C@H]([C@@H]1N)O)O.Cl |
Computed by PubChem (NCBI)