CAS 98541-04-9 is the registry number for Rac-(1r,2r,3r)-3-amino-1,2-cyclopentanediol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
(1R,2R,3R)-3-aminocyclopentane-1,2-diol;hydrochloride (CAS 98541-04-9) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: (1R,2R,3R)-3-aminocyclopentane-1,2-diol;hydrochloride. InChIKey: KGKOUXFBWHTEOL-DEVUXVJFSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | (1R,2R,3R)-3-aminocyclopentane-1,2-diol;hydrochloride |
| InChIKey | KGKOUXFBWHTEOL-DEVUXVJFSA-N |
| SMILES | C1C[C@H]([C@@H]([C@@H]1N)O)O.Cl |
Computed by PubChem (NCBI)