Products 423768-56-3
CAS 423768-56-3 appears in our catalog under these names: 5-Methyl-1-(2-methylphenyl)-1h-pyrazole-4-carboxylic acid, 95%, 5-Methyl-1-(2-methylphenyl)-1H-pyrazole-4-carboxylic acid, 98.0%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
5-methyl-1-(2-methylphenyl)pyrazole-4-carboxylic acid (CAS 423768-56-3) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 5-methyl-1-(2-methylphenyl)pyrazole-4-carboxylic acid. InChIKey: ZAECUUMNEFZBLG-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 5-methyl-1-(2-methylphenyl)pyrazole-4-carboxylic acid |
| InChIKey | ZAECUUMNEFZBLG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=C(C=N2)C(=O)O)C |
Computed by PubChem (NCBI)