Products 42434-88-8
CAS 42434-88-8 is the registry number for 2-(2-Bromophenoxy)-1-phenylethanone, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-(2-bromophenoxy)-1-phenylethanone (CAS 42434-88-8) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: 2-(2-bromophenoxy)-1-phenylethanone. InChIKey: VMCDJFHHWCZFIK-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 2-(2-bromophenoxy)-1-phenylethanone |
| InChIKey | VMCDJFHHWCZFIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)COC2=CC=CC=C2Br |
Computed by PubChem (NCBI)