Products 42497-46-1
CAS 42497-46-1 appears in our catalog under these names: 2,3,4,9-Tetrahydro-1H-carbazole-1-carboxylic Acid, 2,3,4,9-Tetrahydro-1h-carbazole-1-carboxylic acid, 95%. Offered by: TRC, Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
2,3,4,9-tetrahydro-1H-carbazole-1-carboxylic acid (CAS 42497-46-1) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2,3,4,9-tetrahydro-1H-carbazole-1-carboxylic acid. InChIKey: QFLIXPBSNSYURJ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2,3,4,9-tetrahydro-1H-carbazole-1-carboxylic acid |
| InChIKey | QFLIXPBSNSYURJ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C3=CC=CC=C3N2)C(=O)O |
Computed by PubChem (NCBI)