CAS 42524-21-0 is the registry number for 2'-Hydroxy-5'-bromoacetophenone oxime, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-bromo-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol (CAS 42524-21-0) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 4-bromo-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol. InChIKey: GGRZFWDSJRGFPI-BJMVGYQFSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 4-bromo-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol |
| InChIKey | GGRZFWDSJRGFPI-BJMVGYQFSA-N |
| SMILES | C/C(=N\O)/C1=C(C=CC(=C1)Br)O |
Computed by PubChem (NCBI)