CAS 4253-79-6 appears in our catalog under these names: 2-(3-Nitrophenyl)pyridine, 95%, 2-(3-Nitrophenyl)pyridine, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
2-(3-nitrophenyl)pyridine (CAS 4253-79-6) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 2-(3-nitrophenyl)pyridine. InChIKey: OHEKHNZMCAMZNU-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-(3-nitrophenyl)pyridine |
| InChIKey | OHEKHNZMCAMZNU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)