CAS 425607-54-1 is the registry number for Methyl n-(2,5-dimethoxyphenyl)-n-(methylsulfonyl)glycinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(2,5-dimethoxy-N-methylsulfonylanilino)acetate (CAS 425607-54-1) is a chemical compound with the molecular formula C12H17NO6S and a molecular weight of 303.33 g/mol. IUPAC name: methyl 2-(2,5-dimethoxy-N-methylsulfonylanilino)acetate. InChIKey: NATDBDITJDBGGI-UHFFFAOYSA-N.
| Molecular formula | C12H17NO6S |
|---|---|
| Molecular weight | 303.33 g/mol |
| IUPAC name | methyl 2-(2,5-dimethoxy-N-methylsulfonylanilino)acetate |
| InChIKey | NATDBDITJDBGGI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)N(CC(=O)OC)S(=O)(=O)C |
Computed by PubChem (NCBI)