Products 879362-89-7

CAS 879362-89-7 is the registry number for ([(3,4-Diethoxyphenyl)sulfonyl]amino)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-[(3,4-diethoxyphenyl)sulfonylamino]acetic acid (CAS 879362-89-7) is a chemical compound with the molecular formula C12H17NO6S and a molecular weight of 303.33 g/mol. IUPAC name: 2-[(3,4-diethoxyphenyl)sulfonylamino]acetic acid. InChIKey: HPTQKYWBICPVGW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO6S
Molecular weight303.33 g/mol
IUPAC name2-[(3,4-diethoxyphenyl)sulfonylamino]acetic acid
InChIKeyHPTQKYWBICPVGW-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)S(=O)(=O)NCC(=O)O)OCC

Computed by PubChem (NCBI)