CAS 774505-06-5 is the registry number for Faropenem Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5Z)-2-[(1S,2R)-1-carboxy-2-hydroxypropyl]-5-(4-hydroxybutylidene)-2H-1,3-thiazole-4-carboxylic acid (CAS 774505-06-5) is a chemical compound with the molecular formula C12H17NO6S and a molecular weight of 303.33 g/mol. IUPAC name: (2R,5Z)-2-[(1S,2R)-1-carboxy-2-hydroxypropyl]-5-(4-hydroxybutylidene)-2H-1,3-thiazole-4-carboxylic acid. InChIKey: BOALIGCXNFYTIN-MSZSNGJQSA-N.
| Molecular formula | C12H17NO6S |
|---|---|
| Molecular weight | 303.33 g/mol |
| IUPAC name | (2R,5Z)-2-[(1S,2R)-1-carboxy-2-hydroxypropyl]-5-(4-hydroxybutylidene)-2H-1,3-thiazole-4-carboxylic acid |
| InChIKey | BOALIGCXNFYTIN-MSZSNGJQSA-N |
| SMILES | C[C@H]([C@H]([C@@H]1N=C(/C(=C/CCCO)/S1)C(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)