CAS 425623-42-3 is the registry number for 6-Ethynylquinazoline-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethynylquinazoline-2,4-diamine (CAS 425623-42-3) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 6-ethynylquinazoline-2,4-diamine. InChIKey: GNPJZSVYBLENRR-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 6-ethynylquinazoline-2,4-diamine |
| InChIKey | GNPJZSVYBLENRR-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)N=C(N=C2N)N |
Computed by PubChem (NCBI)