CAS 426226-35-9 appears in our catalog under these names: Methyl (1r,4s)-4-aminocyclopent-2-ene-1-carboxylate hydrochloride, 95%, Peramivir Impurity 13 HCl, (1R,4S)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester Hydrochloride, (1R,4S)-Methyl 4-aminocyclopent-2-enecarboxylate hydrochloride, >97%, >97%, methyl (1R,4S)-4-aminocyclopent-2-ene-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, on request, 10g, 100mg, 25g, 500mg.
Methyl (1R,4S)-4-aminocyclopent-2-ene-1-carboxylate;hydrochloride (CAS 426226-35-9) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: methyl (1R,4S)-4-aminocyclopent-2-ene-1-carboxylate;hydrochloride. InChIKey: SWYRZYIXFKDJEK-RIHPBJNCSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | methyl (1R,4S)-4-aminocyclopent-2-ene-1-carboxylate;hydrochloride |
| InChIKey | SWYRZYIXFKDJEK-RIHPBJNCSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](C=C1)N.Cl |
Computed by PubChem (NCBI)