CAS 77745-25-6 appears in our catalog under these names: (1S,4R)-Methyl-4-aminocyclopentyl-2-enecarboxylate Hydrochloride, cis-Methyl 4-aminocyclopent-2-enecarboxylate hydrochloride, 95+%, (1S,4R)-Methyl-4-aminocyclopentyl-2-enecarboxylate Hydrochloride, ≥95%, ≥95%. Offered by: TRC, AmBeed, Chemat. Available pack sizes: 500mg, 5g, 100mg, 250mg, 1g.
Methyl (1S,4R)-4-aminocyclopent-2-ene-1-carboxylate;hydrochloride (CAS 77745-25-6) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: methyl (1S,4R)-4-aminocyclopent-2-ene-1-carboxylate;hydrochloride. InChIKey: SWYRZYIXFKDJEK-IBTYICNHSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | methyl (1S,4R)-4-aminocyclopent-2-ene-1-carboxylate;hydrochloride |
| InChIKey | SWYRZYIXFKDJEK-IBTYICNHSA-N |
| SMILES | COC(=O)[C@H]1C[C@H](C=C1)N.Cl |
Computed by PubChem (NCBI)