CAS 4269-17-4 appears in our catalog under these names: 4–Bromo–9H–fluoren–9–one, 4-Bromo-9H-fluoren-9-one 98%, 4-Bromo-9H-fluoren-9-one, 98%, 4-Bromo-9H-fluoren-9-one, >98.0%(GC), 4-Bromo-9H-fluoren-9-one, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
4-bromofluoren-9-one (CAS 4269-17-4) is a chemical compound with the molecular formula C13H7BrO and a molecular weight of 259.10 g/mol. IUPAC name: 4-bromofluoren-9-one. InChIKey: YWYZCXNQMZOYHM-UHFFFAOYSA-N.
| Molecular formula | C13H7BrO |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 4-bromofluoren-9-one |
| InChIKey | YWYZCXNQMZOYHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=CC=C3Br |
Computed by PubChem (NCBI)