Products 42754-61-0
CAS 42754-61-0 appears in our catalog under these names: Ibrutinib Impurity 110, 3-Amino-5-phenyl-1H-pyrazole-4-carbonitrile, 97%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g, 250mg, 100mg.
3-amino-5-phenyl-1H-pyrazole-4-carbonitrile (CAS 42754-61-0) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 3-amino-5-phenyl-1H-pyrazole-4-carbonitrile. InChIKey: PGZXQQILVKKFAU-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 3-amino-5-phenyl-1H-pyrazole-4-carbonitrile |
| InChIKey | PGZXQQILVKKFAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NN2)N)C#N |
Computed by PubChem (NCBI)