CAS 42771-79-9 appears in our catalog under these names: Flurbiprofen EP Impurity D, Flurbiprofen Impurity D, 4-Acetyl-2-fluorobiphenyl, >95% (HPLC), 1–(2–fluoro–(1,1'–biphenyl)–4–yl)ethan–1–one, 1-(2-Fluoro[1,1'-biphenyl]-4-yl)ethanone, 97%, 97%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 250mg, 500mg, 50mg, 100mg, 25mg, 1g, 100 mg.
1-(3-fluoro-4-phenylphenyl)ethanone (CAS 42771-79-9) is a chemical compound with the molecular formula C14H11FO and a molecular weight of 214.23 g/mol. IUPAC name: 1-(3-fluoro-4-phenylphenyl)ethanone. InChIKey: ZLKQQDFLPVWFDT-UHFFFAOYSA-N.
| Molecular formula | C14H11FO |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | 1-(3-fluoro-4-phenylphenyl)ethanone |
| InChIKey | ZLKQQDFLPVWFDT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)