Products 42771-82-4
CAS 42771-82-4 appears in our catalog under these names: Flurbiprofen Impurity 2, Flurbiprofen impurity 29, 2-(2-Fluoro-(1,1'-biphenyl)-4-yl)-2-methylmalonic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg.
2-(3-fluoro-4-phenylphenyl)-2-methylpropanedioic acid (CAS 42771-82-4) is a chemical compound with the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. IUPAC name: 2-(3-fluoro-4-phenylphenyl)-2-methylpropanedioic acid. InChIKey: AHAWBBIKBPNXOF-UHFFFAOYSA-N.
| Molecular formula | C16H13FO4 |
|---|---|
| Molecular weight | 288.27 g/mol |
| IUPAC name | 2-(3-fluoro-4-phenylphenyl)-2-methylpropanedioic acid |
| InChIKey | AHAWBBIKBPNXOF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2-Fluorobiphenyl-4-yl)-2,3-dimethylbutanedioic acid, FLURBIPROFEN IMPURITY B (EP IMPURITY), FLURBIPROFEN IMPURITY B [EP IMPURITY], Propanedioic acid, (2-fluoro[1,1'-biphenyl]-4-yl)methyl-, Flurbiprofen Related Impurity 2, 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)-2-methylmalonic acid, Flurbiprofen Impurity 29, 2-(3-fluoro-4-phenylphenyl)-2-methylpropanedioic acid, Flurbiprofen Impurity 55, 2-(2-Fluoro-4-biphenylyl)-2-methylmalonic Acid