CAS 42773-27-3 appears in our catalog under these names: 3-Chloro-3-phenylindolin-2-one, 97%, 3-Chloro-3-phenyl-1,3-dihydroindol-2-one, 97%, 3-Chloro-3-phenyl-1,3-dihydroindol-2-one, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
3-chloro-3-phenyl-1H-indol-2-one (CAS 42773-27-3) is a chemical compound with the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. IUPAC name: 3-chloro-3-phenyl-1H-indol-2-one. InChIKey: OMUUDIAKXGQSPU-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-chloro-3-phenyl-1H-indol-2-one |
| InChIKey | OMUUDIAKXGQSPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3NC2=O)Cl |
Computed by PubChem (NCBI)