CAS 42783-58-4 appears in our catalog under these names: 5-(Benzyloxy)pyrimidin-2-amine 95%, 5-(Benzyloxy)pyrimidin-2-amine, 95+%, 95+%, 5-(Benzyloxy)pyrimidin-2-amine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-phenylmethoxypyrimidin-2-amine (CAS 42783-58-4) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 5-phenylmethoxypyrimidin-2-amine. InChIKey: BRIAQLVXVQRDLK-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 5-phenylmethoxypyrimidin-2-amine |
| InChIKey | BRIAQLVXVQRDLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CN=C(N=C2)N |
Computed by PubChem (NCBI)