CAS 4279-81-6 is the registry number for 3,3–diphenylpropanal. Offered by: GLPBio. Available pack sizes: 1g.
3,3-diphenylpropanal (CAS 4279-81-6) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 3,3-diphenylpropanal. InChIKey: BYNJCCMGUBTMJZ-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 3,3-diphenylpropanal |
| InChIKey | BYNJCCMGUBTMJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)