CAS 4282-50-2 appears in our catalog under these names: 3-(3-Nitrophenyl)pyridine, 95%, 3–(3–Nitrophenyl)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 1g, 5g, 100mg.
3-(3-nitrophenyl)pyridine (CAS 4282-50-2) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 3-(3-nitrophenyl)pyridine. InChIKey: VNYZVWPHCFEYNE-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-(3-nitrophenyl)pyridine |
| InChIKey | VNYZVWPHCFEYNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CN=CC=C2 |
Computed by PubChem (NCBI)