CAS 42823-73-4 appears in our catalog under these names: Methyl 4–Carbamimidoylbenzoate Hydrochloride, Methyl 4-carbamimidoylbenzoate hydrochloride, 4-Methoxycarbonyl-benzamidine hydrochloride, 95%, Methyl 4-carbamimidoylbenzoate hydrochloride, 95%, Methyl 4-Carbamimidoylbenzoate Hydrochloride, 95%, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 2,5g, 25g, 100mg, 10g.
Methyl 4-carbamimidoylbenzoate;hydrochloride (CAS 42823-73-4) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: methyl 4-carbamimidoylbenzoate;hydrochloride. InChIKey: SANDFJWTZYOLPM-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | methyl 4-carbamimidoylbenzoate;hydrochloride |
| InChIKey | SANDFJWTZYOLPM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=N)N.Cl |
Computed by PubChem (NCBI)