Products 42936-88-9

CAS 42936-88-9 is the registry number for 2-(4-Chloro-2-methylphenoxy)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(4-chloro-2-methylphenoxy)-2-methylpropanoic acid (CAS 42936-88-9) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. IUPAC name: 2-(4-chloro-2-methylphenoxy)-2-methylpropanoic acid. InChIKey: GFKKWENTMDBEPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO3
Molecular weight228.67 g/mol
IUPAC name2-(4-chloro-2-methylphenoxy)-2-methylpropanoic acid
InChIKeyGFKKWENTMDBEPJ-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)Cl)OC(C)(C)C(=O)O

Computed by PubChem (NCBI)