CAS 43041-68-5 is the registry number for 4-Chloro-3-nitro-n-propylbenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-chloro-3-nitro-N-propylbenzenesulfonamide (CAS 43041-68-5) is a chemical compound with the molecular formula C9H11ClN2O4S and a molecular weight of 278.71 g/mol. IUPAC name: 4-chloro-3-nitro-N-propylbenzenesulfonamide. InChIKey: LGVAAFDSZVYNED-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O4S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | 4-chloro-3-nitro-N-propylbenzenesulfonamide |
| InChIKey | LGVAAFDSZVYNED-UHFFFAOYSA-N |
| SMILES | CCCNS(=O)(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)