CAS 871824-55-4 is the registry number for JNJ-26489112. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
(2S)-6-chloro-2-[(sulfamoylamino)methyl]-2,3-dihydro-1,4-benzodioxine (CAS 871824-55-4) is a chemical compound with the molecular formula C9H11ClN2O4S and a molecular weight of 278.71 g/mol. IUPAC name: (2S)-6-chloro-2-[(sulfamoylamino)methyl]-2,3-dihydro-1,4-benzodioxine. InChIKey: KXSAIQPPGSSNKX-ZETCQYMHSA-N.
| Molecular formula | C9H11ClN2O4S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | (2S)-6-chloro-2-[(sulfamoylamino)methyl]-2,3-dihydro-1,4-benzodioxine |
| InChIKey | KXSAIQPPGSSNKX-ZETCQYMHSA-N |
| SMILES | C1[C@@H](OC2=C(O1)C=C(C=C2)Cl)CNS(=O)(=O)N |
Computed by PubChem (NCBI)