CAS 612541-07-8 appears in our catalog under these names: 2-Amino-4-chloro-1,3-thiazole-5-carboxylic acid, 2-boc protected, 95%, 2-((tert-Butoxycarbonyl)amino)-4-chlorothiazole-5-carboxylic acid 90%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
4-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid (CAS 612541-07-8) is a chemical compound with the molecular formula C9H11ClN2O4S and a molecular weight of 278.71 g/mol. IUPAC name: 4-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid. InChIKey: NBTRAUIPMWUAHA-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O4S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | 4-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid |
| InChIKey | NBTRAUIPMWUAHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=C(S1)C(=O)O)Cl |
Computed by PubChem (NCBI)