CAS 43068-92-4 is the registry number for 4-chloro-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
4-chloro-1,5-dimethyl-2-phenylpyrazol-3-one (CAS 43068-92-4) is a chemical compound with the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. IUPAC name: 4-chloro-1,5-dimethyl-2-phenylpyrazol-3-one. InChIKey: QCUJRLKNQGXLCW-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 4-chloro-1,5-dimethyl-2-phenylpyrazol-3-one |
| InChIKey | QCUJRLKNQGXLCW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)