CAS 43083-13-2 appears in our catalog under these names: 2-oxo-6-phenyl-1H-pyridine-3-carbonitrile, 95%, 2-Oxo-6-phenyl-1,2-dihydropyridine-3-carbonitrile, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
2-oxo-6-phenyl-1H-pyridine-3-carbonitrile (CAS 43083-13-2) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 2-oxo-6-phenyl-1H-pyridine-3-carbonitrile. InChIKey: KTUZHAVCKLQHCN-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-oxo-6-phenyl-1H-pyridine-3-carbonitrile |
| InChIKey | KTUZHAVCKLQHCN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C(=O)N2)C#N |
Computed by PubChem (NCBI)