Products 43090-68-2
CAS 43090-68-2 appears in our catalog under these names: Phenylephrine EP Impurity A HCl (S-Isomer), Phenylephrine Impurity 2（(S)-Phenylephrine EP Impurity A HCl）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-[(1S)-2-amino-1-hydroxyethyl]phenol;hydrochloride (CAS 43090-68-2) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. IUPAC name: 3-[(1S)-2-amino-1-hydroxyethyl]phenol;hydrochloride. InChIKey: OWMFSWZUAWKDRR-DDWIOCJRSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 3-[(1S)-2-amino-1-hydroxyethyl]phenol;hydrochloride |
| InChIKey | OWMFSWZUAWKDRR-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)O)[C@@H](CN)O.Cl |
Computed by PubChem (NCBI)