CAS 43156-48-5 appears in our catalog under these names: 4-(Phenylthio)-1,2-benzenediamine, 4–(Phenylthio)benzene–1,2–diamine, 4-(Phenylthio)benzene-1,2-diamine, 95%, 95%, 4-(Phenylthio)benzene-1,2-diamine, 95%. Offered by: TRC, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg.
4-phenylsulfanylbenzene-1,2-diamine (CAS 43156-48-5) is a chemical compound with the molecular formula C12H12N2S and a molecular weight of 216.30 g/mol. IUPAC name: 4-phenylsulfanylbenzene-1,2-diamine. InChIKey: YLEPPBFOGUYOEI-UHFFFAOYSA-N.
| Molecular formula | C12H12N2S |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | 4-phenylsulfanylbenzene-1,2-diamine |
| InChIKey | YLEPPBFOGUYOEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)